| Identification | |
| Name: | 2,4-Dichloro-5-fluoropyrimidine |
| Synonyms: | 5-Fluoro-2,4-dichloropyrimidine;2,4-Dichloro-5-fluorouracil; |
| CAS: | 2927-71-1 |
| EINECS: | 249-616-3 |
| Molecular Formula: | C4HCl2FN2 |
| Molecular Weight: | 166.97 |
| InChI: | InChI=1/C4HCl2FN2/c5-3-2(7)1-8-4(6)9-3/h1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 223? |
| Density: | 1.605 g/cm3 |
| Refractive index: | 1.531? |
| Appearance: | Yellow to Orange Crystalline Solid |
| Specification: |
?? 2,4-DiChloro-5-fluoropyrimidine (CAS No.2927-71-1), it also can be called Pyrimidine, 2,4-dichloro-5-fluoro- . |
| Flash Point: | 223? |
| Usage: | Used in the synthesis of two glucuronic derivatives of 5-fluorouracil as neoplasm inhibitors. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
