| Identification | |
| Name: | Benzene, sec-pentyl- |
| Synonyms: | sec-Amylbenzene;sec-Pentylbenzene |
| CAS: | 29316-05-0 |
| EINECS: | 249-553-1 |
| Molecular Formula: | C11H16 |
| Molecular Weight: | 148.27 |
| InChI: | InChI=1/C11H16/c1-3-7-10(2)11-8-5-4-6-9-11/h4-6,8-10H,3,7H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 60.6°C |
| Boiling Point: | 192°Cat760mmHg |
| Density: | 0.859g/cm3 |
| Refractive index: | 1.487 |
| Specification: |
sec-Pentylbenzene (CAS NO.29316-05-0) is also called sec-Amylbenzene ; Benzene, sec-pentyl- . sec-Pentylbenzene (CAS NO.29316-05-0) is low toxic. It is flammable. It will produce stimulation smoke when buring. So the storage environment should be ventilate, low-temperature and dry. |
| Flash Point: | 60.6°C |
| Safety Data | |
 |
|
