| Identification | |
| Name: | Methyl 3-mercaptopropionate |
| Synonyms: | 3-Mercaptopropanoic Acid Methyl Ester; Methyl 3-mercaptopropanoate; 3-Mercaptopropionic acid methyl ester |
| CAS: | 2935-90-2 |
| EINECS: | 220-912-4 |
| Molecular Formula: | C4H8O2S |
| Molecular Weight: | 120.17 |
| InChI: | InChI=1/C4H8O2S/c1-6-4(5)2-3-7/h7H,2-3H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993 3/PG 3 |
| Melting Point: | -60 |
| Density: | 1.08 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.462-1.464 |
| Appearance: | clear to pale yellow liquid |
| Specification: |
Methyl 3-mercaptopropionate (2935-90-2) is stench colorless clear liquid, also known as Methyl mercaptopropionate ; 3-Mercaptopropionic acid methyl ester ; Propanoic acid, 3-mercapto-, methyl ester ; Propionic acid, 3-mercapto-, methyl ester ; Methyl .beta.-mercaptopropionate . It can be used as pesticide intermediate. |
| Packinggroup: | II |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Flammables-area. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
