| Identification | |
| Name: | Carbonochloridicacid, 2-propen-1-yl ester |
| Synonyms: | Carbonochloridicacid, 2-propenyl ester (9CI);Formic acid, chloro-, allyl ester (6CI,7CI,8CI);2-Propen-1-yl chloroformate;2-Propenyl chloroformate;Allyl carbonochloridate;Allyloxycarbonyl chloride;Chloroformic acid allyl ester; |
| CAS: | 2937-50-0 |
| EINECS: | 220-916-6 |
| Molecular Formula: | C4H5ClO2 |
| Molecular Weight: | 120.5 |
| InChI: | InChI=1/C4H5ClO2/c1-2-3-7-4(5)6/h2H,1,3H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1722 6.1/PG 1 |
| Flash Point: | 88 oC |
| Density: | 1.136 |
| Stability: | Stable under normal temperatures and pressures. May decompose on exposure to moist air or water. |
| Refractive index: | n20/D 1.422(lit.) |
| Water Solubility: | insoluble |
| Solubility: | insoluble |
| Appearance: | A colorless liquid with a pungent odor. |
| Packinggroup: | I |
| Flash Point: | 88 oC |
| Color: | COLORLESS LIQUID |
| Usage: | Used as intermediates in synthesis of numerous compounds chloroformic esters. |
| Safety Data | |
| Hazard Symbols |
T+: Very toxic
|
 |
|
