| Identification |
| Name: | Butyl acrylate, methyl methacrylate, acrylamide copolymer |
| Synonyms: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with butyl 2-propenoate and 2-propenamide;Butyl acrylate, methyl methacrylate, acrylamide copolymer |
| CAS: | 29405-51-4 |
| Molecular Formula: | C15H25NO5 |
| Molecular Weight: | 299.3627 |
| InChI: | InChI=1S/C7H12O2.C5H8O2.C3H5NO/c1-3-5-6-9-7(8)4-2;1-4(2)5(6)7-3;1-2-3(4)5/h4H,2-3,5-6H2,1H3;1H2,2-3H3;2H,1H2,(H2,4,5) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 39.4°C |
| Boiling Point: | 145.9°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 39.4°C |
| Safety Data |
| |
 |
