| Identification | |
| Name: | Guanosine, 6-seleno- |
| Synonyms: | 9H-Purin-6(1H)-one,2-amino-9-b-D-ribofuranosyl-6-seleno- (8CI);2-Amino-6-selenoxo-9-(b-D-ribofuranosyl)purine; 6-Selenoguanine riboside; 6-Selenoguanosine; NSC137679 |
| CAS: | 29411-74-3 |
| Molecular Formula: | C10H13 N5 O4 Se |
| Molecular Weight: | 346.24 |
| InChI: | InChI=1/C10H12N5O4Se/c11-10-13-7-4(8(20)14-10)12-2-15(7)9-6(18)5(17)3(1-16)19-9/h2-3,5-6,9,16-18H,1H2,(H2,11,13,14)/t3-,5-,6-,9-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3283 6.1/PG 3 |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Specification: |
6-Selenoguanosine ,its CAS NO. is 29411-74-3,the synonyms is 9H-Purine-6(1H)-one, 2-amino-9-beta-D-ribofuranosyl-6-seleno- ; NSC 137679 ; 9H-Purin-6(1H)-one, 2-amino-9-beta-D-ribofuranosyl-6-seleno- ; Guanosine, 6-seleno- (9CI) . |
| Report: |
Selenium and its compounds are on the Community Right-To-Know List. |
| Flash Point: | °C |
| Storage Temperature: | −20°C |
| Safety Data | |
 |
|
