| Identification | |
| Name: | Benzothiazole, 6-nitro- |
| Synonyms: | 6-Nitrobenzothiazole;NSC 170646;6-nitro-1,3-benzothiazole; |
| CAS: | 2942-06-5 |
| EINECS: | 220-933-9 |
| Molecular Formula: | C7H4N2O2S |
| Molecular Weight: | 180.18 |
| InChI: | InChI=1/C7H4N2O2S/c10-9(11)5-1-2-6-7(3-5)12-4-8-6/h1-4H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.525 g/cm3 |
| Refractive index: | 1.729 |
| Specification: | usageEng:A related compound of 1,2,3-benzothiadiazoles Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Storage Temperature: | Refrigerator |
| Usage: | A related compound of 1,2,3-benzothiadiazoles |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
