| Identification | |
| Name: | Benzothiazole,2,7-dichloro- |
| Synonyms: | 2,7-Dichloro-1,3-benzothiazole;2,7-Dichlorobenzothiazole; |
| CAS: | 2942-23-6 |
| Molecular Formula: | C7H3Cl2NS |
| Molecular Weight: | 204.08 |
| InChI: | InChI=1/C7H3Cl2NS/c8-4-2-1-3-5-6(4)11-7(9)10-5/h1-3H |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.567 g/cm3 |
| Refractive index: | 1.701 |
| Specification: |
The cas register number of Retigeric acid A is 2942-23-6. It also can be called as benzothiazole, 2,7-dichloro- and the Systematic name about this chemical is 2,7-dichloro-1,3-benzothiazole. Physical properties about Retigeric acid A are: (1)ACD/LogP: 4.01; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 4.01; (4)ACD/LogD (pH 7.4): 4.01; (5)ACD/BCF (pH 5.5): 655.81; (6)ACD/BCF (pH 7.4): 655.81; (7)ACD/KOC (pH 5.5): 3612.87; (8)ACD/KOC (pH 7.4): 3612.87; (9)#H bond acceptors: 1; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Polar Surface Area: 41.13Å2; (13)Index of Refraction: 1.701; (14)Molar Refractivity: 50.36 cm3; (15)Molar Volume: 130.1 cm3; (16)Surface Tension: 58.6 dyne/cm; (17)Density: 1.567 g/cm3; (18)Flash Point: 127.2 °C; (19)Enthalpy of Vaporization: 50.48 kJ/mol; (20)Boiling Point: 286.8 °C at 760 mmHg; (21)Vapour Pressure: 0.00446 mmHg at 25°C. People can use the following data to convert to the molecule structure. |
| Safety Data | |
 |
|
