| Identification |
| Name: | Acrylonitrile, butyl acrylate, ethyl acrylate polymer |
| Synonyms: | 2-Propenoic acid, butyl ester, polymer with ethyl 2-propenoate and 2-propenenitrile;Acrylonitrile, butyl acrylate, ethyl acrylate polymer |
| CAS: | 29437-34-1 |
| Molecular Formula: | C15H23NO4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C7H12O2.C5H8O2.C3H3N/c1-3-5-6-9-7(8)4-2;1-3-5(6)7-4-2;1-2-3-4/h4H,2-3,5-6H2,1H3;3H,1,4H2,2H3;2H,1H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 39.4°C |
| Boiling Point: | 145.9°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 39.4°C |
| Safety Data |
| |
 |
