Identification |
Name: | Benzaldehyde,2,3,4,5,6-pentachloro-, oxime |
Synonyms: | Benzaldehyde,pentachloro-, oxime (8CI,9CI); CBA; CBA (pesticide); Pentachlorobenzaldehydeoxime; Pentachlorobenzaldoxime |
CAS: | 29450-63-3 |
Molecular Formula: | C7H2 Cl5 N O |
Molecular Weight: | 293.35 |
InChI: | InChI=1/C7H2Cl5NO/c8-3-2(1-13-14)4(9)6(11)7(12)5(3)10/h1,14H |
Molecular Structure: |
 |
Properties |
Flash Point: | 183.2°C |
Boiling Point: | 379.3°Cat760mmHg |
Density: | 1.77g/cm3 |
Refractive index: | 1.634 |
Specification: |
Pentachlorobenzaldehyde oxime , its cas register number is 29450-63-3. It also can be called Benzaldehyde, pentachloro-, oxime ; and CBA (pesticide) .
|
Flash Point: | 183.2°C |
Safety Data |
|
 |