| Identification | |
| Name: | 3,6-Octanedione |
| Synonyms: | octane-3,6-dione; |
| CAS: | 2955-65-9 |
| Molecular Formula: | C8H14O2 |
| Molecular Weight: | 142.2 |
| InChI: | InChI=1/C8H14O2/c1-3-7(9)5-6-8(10)4-2/h3-6H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 82.4°C |
| Boiling Point: | 227.3°Cat760mmHg |
| Density: | 0.918g/cm3 |
| Refractive index: | 1.419 |
| Specification: | Pale Yellow Low Melting Solid usageEng:It is involved in enzymic stereoselective reduction of diketones into chiral diols |
| Flash Point: | 82.4°C |
| Usage: | It is involved in enzymic stereoselective reduction of diketones into chiral diols |
| Safety Data | |
 |
|
