| Identification | |
| Name: | 2-Amino-2',5-dichlorobenzophenone |
| Synonyms: | (2-amino-5-chloro-phenyl)-(2-chlorophenyl)methanone;2-Amino-2,5-dichlorobenzophenone;2-Amino-5,2'-dichlorobenzophenone;2-Amino-2',5'-dichlorobenzophenone;2-Amino-5,2'-Dichlorobenzophenone(CCAB);2-Amino-5,2'-Dichloro benzophenone; |
| CAS: | 2958-36-3 |
| EINECS: | 220-985-2 |
| Molecular Formula: | C13H9Cl2NO |
| Molecular Weight: | 266.13 |
| InChI: | InChI=1/C13H9Cl2NO/c14-8-5-6-12(16)10(7-8)13(17)9-3-1-2-4-11(9)15/h1-7H,16H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 228.1 oC |
| Boiling Point: | 453.6 oC at 760 mmHg |
| Density: | 1.373 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.643 |
| Water Solubility: | Insoluble in water |
| Solubility: | Insoluble in water |
| Appearance: | yellow to yellow-green powder |
| Specification: |
?2-Amino-2',5-dichlorobenzophenone (CAS NO.2958-36-3), its Synonyms are Benzophenone, 2-amino-2',5-dichloro- ; Methanone, (2-amino-5-chlorophenyl)(2-chlorophenyl)- ; (2-Amino-5-chlorophenyl)(2-chlorophenyl)-methanon ; 2-Amino-5,2'-dichlor-benzophenone . It is yellow to yellow-green powder. |
| Flash Point: | 228.1 oC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Usage: | Lorazepam Impurity A. |
| Safety Data | |
 |
|
