Identification |
Name: | Benzoic acid,4-methoxy-, 7-oxo-1,3,5-cycloheptatrien-1-yl ester |
Synonyms: | p-Anisicacid, ester with tropolone (7CI,8CI); NSC 85778 |
CAS: | 2961-86-6 |
Molecular Formula: | C15H12 O4 |
Molecular Weight: | 256.2534 |
InChI: | InChI=1/C15H12O4/c1-18-12-9-7-11(8-10-12)15(17)19-14-6-4-2-3-5-13(14)16/h2-10H,1H3 |
Molecular Structure: |
![(C15H12O4) p-Anisicacid, ester with tropolone (7CI,8CI); NSC 85778](https://img1.guidechem.com/chem/e/dict/42/2961-86-6.jpg) |
Properties |
Flash Point: | 199.5°C |
Boiling Point: | 443.8°C at 760 mmHg |
Density: | 1.25g/cm3 |
Refractive index: | 1.594 |
Flash Point: | 199.5°C |
Safety Data |
|
![](/images/detail_15.png) |