| Identification | |
| Name: | 4-Pyridinol,3,5-dichloro-2,6-dimethyl- |
| Synonyms: | 2,6-Dimethyl-3,5-dichloro-4-pyridinol;3,5-Dichloro-2,6-dimethyl-4-hydroxypyridine;3,5-Dichloro-2,6-dimethyl-4-pyridinol;3,5-Dichloro-2,6-dimethylpyridinol;3,5-Dichloro-4-hydroxy-2,6-dimethylpyridine;Coccidiostat C;Coyden;Coyden 25;Farmcoccid;Lerbek;Methylchloropindol;Methylchlorpindol;Meticlorpindol;NSC 253479;Pharmcoccid;WR 61112; |
| CAS: | 2971-90-6 |
| EINECS: | 221-008-2 |
| Molecular Formula: | C7H7Cl2NO |
| Molecular Weight: | 192.04 |
| InChI: | InChI=1/C7H7Cl2NO/c1-3-5(8)7(11)6(9)4(2)10-3/h1-2H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 70.4°C |
| Boiling Point: | 219.7°C at 760 mmHg |
| Density: | 1.41g/cm3 |
| Refractive index: | 1.578 |
| Appearance: | White to light-brown, crystalline solid |
| Specification: |
Clopidol (CAS NO.2971-90-6) is a white to light-brown, crystalline solid.?It is practically insoluble in water. Administered to poultry to prevent the growth of pathogenic parasites. Clopidol is a non-combustible as a solid, but dust may burn rapidly or explode when mixed with air and ignited. |
| Flash Point: | 70.4°C |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
