| Identification | |
| Name: | Phenol,2-(chloromethyl)-4-nitro- |
| Synonyms: | o-Cresol, a-chloro-4-nitro- (6CI,7CI,8CI);2-(Chloromethyl)-4-nitrophenol; 2-Hydroxy-5-nitrobenzyl chloride; NSC 128135;NSC 541 |
| CAS: | 2973-19-5 |
| EINECS: | 221-012-4 |
| Molecular Formula: | C7H6 Cl N O3 |
| Molecular Weight: | 187.5802 |
| InChI: | InChI=1S/C7H6ClNO3/c8-4-5-3-6(9(11)12)1-2-7(5)10/h1-3,10H,4H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 3261 8/PG 2 |
| Melting Point: | 128 °C (dec.)(lit.) |
| Flash Point: | 179.6°C |
| Boiling Point: | 373.4°C at 760 mmHg |
| Density: | 1.472g/cm3 |
| Refractive index: | 1.614 |
| Specification: | Off-White Solid Safety Statements:26-27-28-36/37/39-45 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 27:Take off immediately all contaminated clothing 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 179.6°C |
| Safety Data | |
 |
|
