| Identification | |
| Name: | Benzaldehyde,3,5-dibromo-4-hydroxy- |
| Synonyms: | 4-Hydroxy-3,5-dibromobenzaldehyde;NSC 72944; |
| CAS: | 2973-77-5 |
| EINECS: | 221-017-1 |
| Molecular Formula: | C7H4Br2O2 |
| Molecular Weight: | 279.91 |
| InChI: | InChI=1/C7H4Br2O2/c8-5-1-4(3-10)2-6(9)7(5)11/h1-3,11H |
| Molecular Structure: |  |
| Properties | |
| Density: | 2.122 g/cm3 |
| Refractive index: | 1.687 |
| Appearance: | Pale yellow flake crystal powder |
| Specification: | pink to pale brown crystalline powder or needles Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Sensitive: | Air Sensitive |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
