| Identification | |
| Name: | Benzene,dichloromethyl- |
| Synonyms: | Toluene,ar,ar'-dichloro- (8CI);Dichlorotoluene; |
| CAS: | 29797-40-8 |
| EINECS: | 249-854-8 |
| Molecular Formula: | C7H6 Cl2 |
| Molecular Weight: | 161.03 |
| InChI: | InChI=1/C7H6Cl2/c8-7(9)6-4-2-1-3-5-6/h1-5,7H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2810 |
| Melting Point: | -16.4 DEG C |
| Flash Point: | 80.9°C |
| Boiling Point: | 202°Cat760mmHg |
| Density: | 0.993g/cm3 |
| Refractive index: | n20/D 1.55(lit.) |
| Solubility: | INSOL IN WATER SOL IN DILUTE ALKALI > 10% in ethanol > 10% in ether Soluble in most org solvents. |
| Specification: |
A colorless liquid. Not soluble in water. Density about 8.9 lb / gal. Hence sinks in water. Flash point below 141°F. May be irritating and narcotic in high concentrations. Used as a solvent and as an intermediate to make chemicals and dyes.Simple aromatic halogenated organic compounds are very unreactive; halogenated aliphatic compounds are moderately or very reactive. For both subgroups, reactivity generally decreases with increased degree of substitution of halogen for hydrogen atoms. |
| Packinggroup: | III |
| Flash Point: | 80.9°C |
| Color: | COLORLESS OILY LIQUID |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
