| Identification | |
| Name: | Carbamazepine-d10 |
| Synonyms: | carbamazepine; 5-carbamoyl-5h-dibenz[b,f]azepine; 5h-dibenz[b,f]azepine-5-carboxamide |
| CAS: | 298-46-4 |
| EINECS: | 206-062-7 |
| Molecular Formula: | C15H12N2O |
| Molecular Weight: | 236.27 |
| InChI: | InChI=1/C15H12N2O/c16-15(18)17-13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)17/h1-10H,(H2,16,18) |
| Molecular Structure: | ![(C15H12N2O) carbamazepine; 5-carbamoyl-5h-dibenz[b,f]azepine; 5h-dibenz[b,f]azepine-5-carboxamide](https://img.guidechem.com/casimg/298-46-4.gif) |
| Properties | |
| Transport: | 20kgs |
| Density: | 1.266g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.669 |
| Water Solubility: | pract. insoluble |
| Solubility: | practically insoluble (soluble in alcohol and in acetone) |
| Appearance: | white to off-white powder |
| Specification: |
?Carbamazepine ,its cas register number is 298-46-4. It can be called Finlepsin and Tegretol . And it has been sold under the names Biston, Tegretol, Calepsin, Equetro, Finlepsin, Sirtal, Carbatrol, Epitol, Stazepine, Telesmin, Teril, Trimonil, Timonil, Epimaz, Amizepin (Poland), Hermolepsin (Sweden), Carbama/Carbamaze (New Zealand), and Degranol (South Africa). |
| Packinggroup: | III |
| Color: | Crystals from absolute ethanol and benzene White to off-white powder |
| Usage: | Used in treatment of pain associated with trigeminal neuralgia. Anticonvulsant |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
