| Identification | |
| Name: | 2-Piperidineaceticacid, a-phenyl-, methyl ester,hydrochloride (1:1) |
| Synonyms: | 2-Piperidineaceticacid, a-phenyl-, methyl ester,hydrochloride (6CI,8CI,9CI); Centedrin; Centedrine; Concerta; Medikinet;Meridil; Metadate CD; Methyl a-phenyl-2-piperidineacetate hydrochloride; Methylphenidate hydrochloride;NSC 169868; Ritalin; Ritalin Hydrochloride; Ritalin SR |
| CAS: | 298-59-9 |
| EINECS: | 206-065-3 |
| Molecular Formula: | C14H19 N O2 . Cl H |
| Molecular Weight: | 269.7671 |
| InChI: | InChI=1S/C14H19NO2.ClH/c1-17-14(16)13(11-7-3-2-4-8-11)12-9-5-6-10-15-12;/h2-4,7-8,12-13,15H,5-6,9-10H2,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3249 |
| Melting Point: | 224 - 226 ºC |
| Density: | g/cm3 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, alkalies, barbiturates. |
| Refractive index: | 1.523 |
| Water Solubility: | Water solubility: moderate |
| Solubility: | Water solubility: moderate |
| Appearance: | white crystalline powder |
| Specification: | white crystalline powder usageEng:Controlled substance (stimulant). CNS stimulant. Four isomers of Methylphenidate are known to exist. One pair of threo isomers and one pair of erythro are distinguished, from which only d-threo-Methylphenidate exhibits the pharmacologically usually desire Safety Statements:22-26-36 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Packinggroup: | III |
| Biological Activity: | Psychomotor stimulant. Inhibitor of dopamine and noradrenalin transporters that increases the extracellular concentration of dopamine and noradrenalin. Increases locomotor activity in vivo . |
| Storage Temperature: | Store at RT |
| Usage: | Controlled substance (stimulant). CNS stimulant |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
