| Identification | |
| Name: | 2,3,5-Triphenyltetrazolium chloride |
| Synonyms: | 2,3,5-Triphenyl-2H-tetrazoliumchloride (6CI);2H-Tetrazolium, 2,3,5-triphenyl-, chloride (8CI,9CI);1,3,5-Triphenyl-2H-tetrazoliumchloride;Red tetrazolium;Tetrazoliumchloride;Tetrazolium red;Urocheck;Uroscreen;Vitastain;Triphenyltetrazolium chloride; |
| CAS: | 298-96-4 |
| EINECS: | 206-071-6 |
| Molecular Formula: | C19H15N4Cl |
| Molecular Weight: | 334.8022 |
| InChI: | InChI=1S/C19H15N4.ClH/c1-4-10-16(11-5-1)19-20-22(17-12-6-2-7-13-17)23(21-19)18-14-8-3-9-15-18;/h1-15H;1H/q+1;/p-1 |
| Molecular Structure: |  |
| Properties | |
| Boiling Point: | >360 |
| Stability: | Stable. Light sensitive. Protect from moisture. Incompatible with strong oxidizing agents. |
| Water Solubility: | Soluble in water |
| Solubility: | Soluble in water |
| Appearance: | White to yellow with a light tan cast powder |
| Specification: |
Product Categories of Triphenyltetrazolium chloride (CAS NO.298-96-4):Tetrazolium Salts & Formazans;Tetrazolium Salts |
| Report: |
Reported in EPA TSCA Inventory. |
| Sensitive: | Light Sensitive & Hygroscopic |
| Color: | faint yellow |
| Usage: | Substance is used in analytical chemistry as a sensitive reagent for reducing sugars, and to distinguish between ketols and simple aldehydes. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
