| Identification | |
| Name: | Oxirane,2-decyl-3-(5-methylhexyl)-, (2R,3S)-rel- |
| CAS: | 29804-22-6 |
| EINECS: | 249-861-6 |
| Molecular Formula: | C19H38 O |
| Molecular Weight: | 282.57 |
| InChI: | InChI=1S/C19H38O/c1-4-5-6-7-8-9-10-11-15-18-19(20-18)16-13-12-14-17(2)3/h17-19H,4-16H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 139.7°C |
| Boiling Point: | 340.6°Cat760mmHg |
| Density: | 0.844g/cm3 |
| Refractive index: | 1.448 |
| Specification: |
cis-7,8-Epoxy-2-methyloctadecane , its cas register number is 29804-22-6. It also can be called (+-)-Disparlure ; (+-)-cis-Disparlure ; (Z)-7,8-Epoxy-2-methyloctadecane ; Atralymon ; Disparlure ;Epoxan ; cis-2-Decyl-3-(5-methylhexyl)oxirane ; cis-7,8-Epoxy-2-methyloctadecane ; and Disparlure (2S-cis) . Its classification code are Agricultural Chemical; Insect attractant, repellent and chemosterilant; Insecticide and Pheromone. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 139.7°C |
| Safety Data | |
 |
|
