| Identification | |||||||||||||
| Name: | Piperidine,1-(1-cyclohexen-1-yl)- | ||||||||||||
| Synonyms: | 1-(1-Cyclohexen-1-yl)piperidine;1-(Cyclohex-1-enyl)piperidine;1-Piperidino-1-cyclohexene;1-Piperidinocyclohexene;1-Piperidinylcyclohexene;N-(1-Cyclohexen-1-yl)piperidine;N-(1-Cyclohexenyl)piperidine; | ||||||||||||
| CAS: | 2981-10-4 | ||||||||||||
| Molecular Formula: | C11H19 N | ||||||||||||
| Molecular Weight: | 165.27 | ||||||||||||
| InChI: | InChI=1/C11H19N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h7H,1-6,8-10H2 | ||||||||||||
| Molecular Structure: |  |
||||||||||||
| Properties | |||||||||||||
| Flash Point: | 102.8°C | ||||||||||||
| Boiling Point: | 262.2°Cat760mmHg | ||||||||||||
| Density: | 0.978g/cm3 | ||||||||||||
| Refractive index: | 1.5140 | ||||||||||||
| Appearance: | Clear yellow liquid | ||||||||||||
| Specification: |
The 1-(1-Piperidino)cyclohexene with the cas number 2981-10-4, is also called 1-(1-Cyclohexen-1-yl)piperidine. The systematic name is Piperidine, 1-(1-cyclohexen-1-yl)-. This chemical is Clear yellow liquid. Its product category is API intermediates. Preparation: This chemical can be prepared by the reaction of piperidine and cyclohexanone. This reaction needs reagent PTSA and solvent benzene at heating condition. The yield is 78%. Uses: This chemical can prepare 1-cyclohexyl-piperidine. This reaction needs reagent benzyltriphenylphosphonium borohydride and solvent methanol at temperature of 20 ºC. The reaction time is 20 min. The yield is 90%. When you are using this chemical, please be cautious about it as the following: (1)Harmful if swallowed; (2)Irritating to eyes and skin; (3)In case of contact with eyes, rinse immediately with plenty of water and seek medical advice; (4)Wear suitable protective clothing, gloves and eye/face protection. You can still convert the following datas into molecular structure: The toxicity data is as follows:
| ||||||||||||
| Flash Point: | 102.8°C | ||||||||||||
| Safety Data | |||||||||||||
 |
|||||||||||||
