Identification |
Name: | Phenazine methosulfate |
Synonyms: | N-Methylphenazonium methyl sulphate; PMS; 5-methylphenazinium methyl sulphate; Phenazine methosulphate; Phenazine Methoshlphate; N-Methylphenazine methylsulfate salt |
CAS: | 299-11-6 |
EINECS: | 206-072-1 |
Molecular Formula: | C13H11N2?CH3O4S |
Molecular Weight: | 306.34 |
InChI: | InChI=1/C13H11N2.CH4O4S/c1-15-12-8-4-2-6-10(12)14-11-7-3-5-9-13(11)15;1-5-6(2,3)4/h2-9H,1H3;1H3,(H,2,3,4)/q+1;/p-1 |
Molecular Structure: |
 |
Properties |
Transport: | 2811 |
Flash Point: | °C |
Boiling Point: | °Cat760mmHg |
Density: | g/cm3 |
Stability: | Stable. Incompatible with strong oxidizing agents. |
Water Solubility: | soluble |
Appearance: | yellow crystalline |
Flash Point: | °C |
Storage Temperature: | 2-8°C |
Usage: | Used as a an electron carrier in place of the flavine enzyme of warburg in the hexosemonophosphate system: dickens, loc. |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
 |