| Identification | |
| Name: | Potassium gluconate |
| Synonyms: | D-Gluconicacid, monopotassium salt (9CI);Gluconic acid, monopotassium salt, D- (8CI);Gluconic acid potassium salt;Gluconsan K;Helshas K;K-IAO;Kalimozan;Kalium-Beta;Kaon;Katorin;Katrin;Potalium;Potasoral;Potassium D-gluconate;Potassuril;Sirokal;Tumil K; |
| CAS: | 299-27-4 |
| EINECS: | 206-074-2 |
| Molecular Formula: | C6H11O7K |
| Molecular Weight: | 234.24564 |
| InChI: | InChI=1S/C6H12O7.K/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-5,7-11H,1H2,(H,12,13);/q;+1/p-1/t2-,3-,4+,5-;/m1./s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 50kgs |
| Flash Point: | 375.2 oC |
| Boiling Point: | 673.6 oC at 760 mmHg |
| Density: | 1.73 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Water Solubility: | Soluble |
| Solubility: | Soluble |
| Appearance: | white to off-white crystalline or granular powder |
| Specification: |
? Potassium gluconate (CAS NO.299-27-4), its Synonyms are D-Gluconic acid, monopotassium salt ; Gluconic acid potassium salt ; Gluconic acid, monopotassium salt ; Gluconsan K ; K-Iao ; KOK ; Kalium Gluconate ; Kalium-beta ; Kaon ; Kaon elixir ; Katorin ; Monopotassium D-gluconate ; Potalium ; Potasoral ; Potassium D-gluconate . It is white to off-white crystalline or granular powder. |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29181600 |
| Flash Point: | 375.2 oC |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Color: | YELLOWISH-WHITE CRYSTALS |
| Usage: | Major uses include medication. |
| Safety Data | |
 |
|
