| Identification |
| Name: | 2-Propenoic acid,3-(1H-indol-3-yl)-, (2E)- |
| Synonyms: | trans-b-Indoleacrylic acid;(E)-3-(1H-Indol-3-yl)-2-propenoic acid;Indole-3-acrylic acid, (E)- (8CI);2-Propenoicacid, 3-(1H-indol-3-yl)-, (E)-;(2E)-3-(1H-Indol-3-yl)acrylic acid;(2E)-3-(1H-indol-3-yl)prop-2-enoic acid;2-Propenoic acid, 3- (1H-indol-3-yl)-;2-propenoic acid, 3-(1H-indol-3-yl)-, (2E)-;Acide (2E)-3-(1H-indol-3-yl)acrylique; |
| CAS: | 29953-71-7 |
| EINECS: | 214-872-7 |
| Molecular Formula: | C11H9NO2 |
| Molecular Weight: | 187.2 |
| InChI: | InChI=1/C11H10N2O2/c12-15-11(14)6-5-8-7-13-10-4-2-1-3-9(8)10/h1-7,13H,12H2/b6-5+ |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 215.6 ºC |
| Boiling Point: | 432.8 ºC at 760 mmHg |
| Density: | 1.361 g/cm3 |
| Refractive index: | 1.727 |
| Water Solubility: | freely soluble |
| Solubility: | freely soluble in water |
| Appearance: | white to light yellow powder |
| Flash Point: | 215.6 ºC |
| Color: | white to light yellow |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
