| Identification | |
| Name: | Phenol,2-[(ethylthio)methyl]-, 1-(N-methylcarbamate) |
| Synonyms: | Carbamicacid, methyl-, a-(ethylthio)-o-tolylester (8CI);Phenol, 2-[(ethylthio)methyl]-, methylcarbamate (9CI);o-Cresol, a-(ethylthio)-, methylcarbamate(8CI);2-[(Ethylthio)methyl]phenyl methylcarbamate;Arylmate;BAY-HOX 1901;Chox 1901;Croneton;Croneton 500;Ethiofencarb;HOX 1901;a-(Ethylthio)-o-tolylmethylcarbamate; |
| CAS: | 29973-13-5 |
| EINECS: | 249-981-9 |
| Molecular Formula: | C11H15 N O2 S |
| Molecular Weight: | 225.33 |
| InChI: | InChI=1/C11H15NO2S/c1-3-15-8-9-6-4-5-7-10(9)14-11(13)12-2/h4-7H,3,8H2,1-2H3,(H,12,13) |
| Molecular Structure: | ![(C11H15NO2S) Carbamicacid, methyl-, a-(ethylthio)-o-tolylester (8CI);Phenol, 2-[(ethylthio)methyl]-, methylcarbam...](https://img1.guidechem.com/chem/e/dict/178/29973-13-5.jpg) |
| Properties | |
| Melting Point: | 33.4 deg C |
| Flash Point: | 151.7°C |
| Boiling Point: | 327.3°Cat760mmHg |
| Density: | 1.131g/cm3 |
| Refractive index: | 1.549 |
| Solubility: | In dichloromethane, isopropanol and toluene >200, hexane 5-10 (all in g/l, 20 deg C). In water, 1.82 g/l at 20 deg C |
| Specification: |
2-Ethylthiomethylphenyl N-methylcarbamate ,its cas register number is 29973-13-5. It also can be called Ethiofencarb ; 2-[(Ethylsulfanyl)methyl]phenyl-methylcarbamat ; a-Ethylthio-o-tolyl Methylcarbamate ; Dalf dust ; Boruho 50 and Croneton . |
| Flash Point: | 151.7°C |
| Color: | Colourless crystals. |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
N: Dangerous for the environment
|
 |
|
