| Identification |
| Name: | Ethyl isocyanoacetate |
| Synonyms: | Aceticacid, isocyano-, ethyl ester (7CI,8CI,9CI); (Ethoxycarbonyl)methyl isonitrile;2-Ethoxy-2-oxoethyl isocyanide; Ethoxycarbonylmethyl isocyanide; Ethyl2-isocyanoacetate; Ethyl isocyanoacetate; Ethyl a-isocyanoacetate; Isocyanoacetic acid ethyl ester; a-Isocyanoacetic acid ethyl ester |
| CAS: | 2999-46-4 |
| EINECS: | 221-077-9 |
| Molecular Formula: | C5H7NO2 |
| Molecular Weight: | 113.11 |
| InChI: | InChI=1/C5H7NO2/c1-3-8-5(7)4-6-2/h3-4H2,1H3 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2810 6 |
| Melting Point: | 194-196ºC |
| Density: | 1.03 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.417-1.425 |
| Appearance: | Light yellow to brom liquid |
| Packinggroup: | III |
| Storage Temperature: | 2-8°C |
| Sensitive: | Moisture & Light Sensitive |
| Safety Data |
| Hazard Symbols |
Xn:Harmful
|
| |
 |
