| Identification | |
| Name: | Quinoline, 4-methyl-,hydrochloride (1:1) |
| Synonyms: | Lepidine,hydrochloride (6CI,8CI); Quinoline, 4-methyl-, hydrochloride (9CI);4-Methylquinoline hydrochloride |
| CAS: | 3007-43-0 |
| EINECS: | 221-115-4 |
| Molecular Formula: | C10H9 N . Cl H |
| Molecular Weight: | 179.6461 |
| InChI: | InChI=1/C10H9N.ClH/c1-8-6-7-11-10-5-3-2-4-9(8)10;/h2-7H,1H3;1H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 9.5 deg C |
| Flash Point: | 218.8°C |
| Boiling Point: | 376.3°Cat760mmHg |
| Density: | 1.188g/cm3 |
| Solubility: | Slightly soluble in water Soluble in ethanol, ether, and acetone. Miscible with alcohol and benzene Soluble in mineral acid; insoluble in alkali In water, 783 mg/liter @ 25 deg C |
| Flash Point: | 218.8°C |
| Color: | Colorless, oily liquid |
| Safety Data | |
 |
|
