Identification |
Name: | Dodecanamide,N,N-dimethyl- |
Synonyms: | BRN 1769950;AI3-26661;Lauryl N,N-dimethylamide;N,N-Dimethyl laurylamide;N,N-Dimethyldodecamide;N,N-Dimethyllauramide;NSC76600;Hallcomid M12; |
CAS: | 3007-53-2 |
EINECS: | 221-117-5 |
Molecular Formula: | C14H29NO |
Molecular Weight: | 227.3862 |
InChI: | InChI=1/C14H29NO/c1-4-5-6-7-8-9-10-11-12-13-14(16)15(2)3/h4-13H2,1-3H3 |
Molecular Structure: |
 |
Properties |
Transport: | UN 3082 |
Density: | 0.87 |
Refractive index: | 1.447 |
Appearance: | Colorless transparent liquid |
Specification: |
To protect yourself, you can put eyeshields, gloves, half-mask respirator (EU), half-mask respirator (US), multi-purpose combination respirator cartridge (US).
|
Report: |
Reported in EPA TSCA Inventory.
|
Safety Data |
Hazard Symbols |
N: Dangerous for the environment
|
|
 |