| Identification | |
| Name: | Dodecanoic acid,2-thiocyanatoethyl ester |
| Synonyms: | Lauricacid, 2-thiocyanatoethyl ester (6CI,7CI,8CI); Lauric acid, 2-thiocyanoethylester (4CI); Thiocyanic acid, 2-hydroxyethyl ester, laurate (4CI,8CI);2-Thiocyanatoethyl laurate; 2-Thiocyanoethyl dodecanoate; 2-Thiocyanoethyllaurate; Lethane 60; NSC 403654; b-Thiocyanoethyl laurate |
| CAS: | 301-11-1 |
| EINECS: | 206-109-1 |
| Molecular Formula: | C15H27 N O2 S |
| Molecular Weight: | 285.49 |
| InChI: | InChI=1/C15H27NO2S/c1-2-3-4-5-6-7-8-9-10-11-15(17)18-12-13-19-14-16/h2-13H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 192°C |
| Boiling Point: | 393.9°Cat760mmHg |
| Density: | 0.994g/cm3 |
| Refractive index: | 1.477 |
| Specification: |
Lethane 60 , its cas register number is 301-11-1. It also can be called 2-Thiocyanatoethyl dodecanoate ; 2-Thiocyanatoethyl laurate ; 2-Thiocyanoethyl coconate ; 2-Thiocyanoethyl dodecanoate ; 2-Thiocyanoethyl laurate ; 2-Thiokyanatoethylester kyseliny laurove ; 2-Thiokyanatoethylester kyseliny laurove [Czech] ; 3-03-00-00286 (Beilstein Handbook Reference) ; BRN 1794076 ; Caswell No. 085 ; Dodecanoic acid 2-thiocyanatoethyl ester ; EINECS 206-109-1 ; ENT 5 ; EPA Pesticide Chemical Code 010101 ; Lauric acid ester with 2-hydroxyethyl thiocyanate ; Lethane 384 special ; NSC 403654 ; Thiocyanic acid, 2-hydroxyethyl ester laurate (ester) ; Thiocyanic acid, 2-hydroxyethyl ester, laurate ; beta-Thiocyanoethyl laurate ; 2-Thiocyanatoethyl laurate ; Dodecanoic acid, 2-thiocyanatoethyl ester ; Dodecanoic acid, 2-thiocyanatoethyl ester (9CI) ; Lauric acid, 2-thiocyanatoethyl ester . |
| Flash Point: | 192°C |
| Safety Data | |
 |
|
