| Identification | |
| Name: | Pentanoic acid,2-propyl-, 2-methyl-5-(1-methylethyl)phenyl ester |
| Synonyms: | Valericacid, 2-propyl-, carvacryl ester (8CI) |
| CAS: | 30129-30-7 |
| Molecular Formula: | C18H28 O2 |
| Molecular Weight: | 276.46 |
| InChI: | InChI=1/C18H28O2/c1-6-8-15(9-7-2)18(19)20-17-12-16(13(3)4)11-10-14(17)5/h10-13,15H,6-9H2,1-5H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 119°C |
| Boiling Point: | 345.8°Cat760mmHg |
| Density: | 0.943g/cm3 |
| Refractive index: | 1.487 |
| Specification: |
Carvacryl 2-propylvalerate , its cas register number is 30129-30-7. It also can be called 2-Propylvaleric acid carvacryl ester ; Pentanoic acid, 2-propyl-, carvaryl ester ; and Valeric acid, 2-propyl-, carvacryl ester . |
| Flash Point: | 119°C |
| Safety Data | |
 |
|
