Identification |
Name: | Benzo[b]thiophene-3-carboxamide,2-[(3,4-dimethoxybenzoyl)amino]-4,5,6,7-tetrahydro- |
Synonyms: | 2-(3,4-DIMETHOXY-BENZOYLAMINO)-4,5,6,7-T;TCS359;2-(3,4-Dimethoxy-benzoylamino)-4,5,6,7-tetrahydro-benzo[b]thiophene-3-carboxylic acid amide;Flt-3 inhibitor |
CAS: | 301305-73-7 |
Molecular Formula: | C18H20 N2 O4 S |
Molecular Weight: | 0 |
InChI: | InChI=1/C18H20N2O4S/c1-23-12-8-7-10(9-13(12)24-2)17(22)20-18-15(16(19)21)11-5-3-4-6-14(11)25-18/h7-9H,3-6H2,1-2H3,(H2,19,21)(H,20,22) |
Molecular Structure: |
 |
Properties |
Flash Point: | 228.6°C |
Boiling Point: | 454.4°Cat760mmHg |
Density: | 1.328g/cm3 |
Refractive index: | 1.644 |
Biological Activity: | Potent inhibitor of FLT3 receptor tyrosine kinase (IC 50 = 42 nM) that displays selectivity over a range of other kinases. Exhibits antiproliferative effects on MV4-11 cells, a human acute myelogenous leukaemia cell line expressing a constitutively active mutant FLT3 (IC 50 = 340 nM). |
Flash Point: | 228.6°C |
Storage Temperature: | −20°C |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |