| Identification | |
| Name: | 3-Methylphenol sodium salt |
| Synonyms: | Sodium 3-methylphenoxide;Sodium m-cresolate;Sodium m-methylphenolate;m-Cresol, sodium salt |
| CAS: | 3019-89-4 |
| EINECS: | 221-167-8 |
| Molecular Formula: | C7H8 O . Na |
| Molecular Weight: | 130.13 |
| InChI: | InChI=1/C7H8O.Na/c1-6-3-2-4-7(8)5-6;/h2-5,8H,1H3;/q;+1/p-1 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 11-12 deg C |
| Flash Point: | 278°C |
| Boiling Point: | 727.8°Cat760mmHg |
| Density: | 1.815g/cm3 |
| Solubility: | In solutions of fixed alkali hydroxides; miscible in alcohol; chloroform; ether Miscible in ethanol, ether, and acetone 2.5% IN MINERAL OIL In water, 2.27X10+4 mg/L at 25 deg C. |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 278°C |
| Color: | Colorless, yellowish, brownish-yellow, or pinkish liquid Colorless to yellow liquid [Note: A solid below 54 degrees F]. |
| Safety Data | |
 |
|
