| Identification | |
| Name: | Pyrrolidinone, methyl- |
| Synonyms: | Methylpyrrolidinone |
| CAS: | 30207-69-3 |
| Molecular Formula: | C5H9 N O |
| Molecular Weight: | 99.13106 |
| InChI: | InChI=1S/C5H9NO/c1-6-4-2-3-5(6)7/h2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | -25 deg C |
| Boiling Point: | 202 deg C @ 760 mm Hg |
| Solubility: | Miscible with castor oil. Miscible with water, lower alcohols & ketones, ethyl acetate, chloroform and benzene. Moderately soluble in aliphatic hydrocarbons and dissolves many organic and inorganic compounds. |
| Color: | Colorless liquid |
| Safety Data | |
 |
|
