| Identification | |
| Name: | 2-Thiazolamine,4-(2-pyridinyl)- |
| Synonyms: | Pyridine,2-(2-amino-4-thiazolyl)- (6CI,8CI);4-(2-Pyridinyl)thiazol-2-amine;[4-(Pyridin-2-yl)thiazol-2-yl]amine; |
| CAS: | 30235-26-8 |
| Molecular Formula: | C8H7N3S |
| Molecular Weight: | 177.23 |
| InChI: | InChI=1/C8H7N3S/c9-8-11-7(5-12-8)6-3-1-2-4-10-6/h1-5H,(H2,9,11) |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.333 g/cm3 |
| Refractive index: | 1.669 |
| Specification: |
The 4-(Pyridin-2-yl)thiazol-2-amine with the CAS number 30235-26-8 is also called 2-Thiazolamine,4-(2-pyridinyl)-. The systematic name is 4-(pyridin-2-yl)-1,3-thiazol-2-amine. Its molecular formula is C8H7N3S. This chemical is irritant. While using this chemical, you should be very cautious. The properties of the 4-(Pyridin-2-yl)thiazol-2-amine are: (1)ACD/LogP: 0.79; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 0.76; (4)ACD/LogD (pH 7.4): 0.79; (5)ACD/BCF (pH 5.5): 2.17; (6)ACD/BCF (pH 7.4): 2.35; (7)ACD/KOC (pH 5.5): 59.31; (8)ACD/KOC (pH 7.4): 64.16; (9)#H bond acceptors: 3; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 1; (12)Polar Surface Area: 57.26 Å2; (13)Index of Refraction: 1.669; (14)Molar Refractivity: 49.64 cm3; (15)Molar Volume: 132.9 cm3; (16)Polarizability: 19.68×10-24cm3; (17)Surface Tension: 65.3 dyne/cm; (18)Enthalpy of Vaporization: 63.21 kJ/mol; (19)Vapour Pressure: 4.36×10-6 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
