| Identification | |
| Name: | Phenol,3-methyl-6-(1-methylethyl)-2,4-dinitro- |
| Synonyms: | Thymol,2,6-dinitro- (6CI,7CI,8CI); 2,4-Dinitrothymol; 2,6-Dinitrothymol;2-Isopropyl-5-methyl-4,6-dinitrophenol; NSC 6767 |
| CAS: | 303-21-9 |
| EINECS: | 206-135-3 |
| Molecular Formula: | C10H12 N2 O5 |
| Molecular Weight: | 240.24 |
| InChI: | InChI=1/C10H12N2O5/c1-5(2)7-4-8(11(14)15)6(3)9(10(7)13)12(16)17/h4-5,13H,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 128.8°C |
| Boiling Point: | 311.7°Cat760mmHg |
| Density: | 1.35g/cm3 |
| Refractive index: | 1.592 |
| Specification: |
2,4-Dinitrothymol ,its cas register number is 303-21-9. It also can be called 2,4-Dinitro-6-isopropyl-3-methylphenol ; 2-Isopropyl-5-methyl-4,6-dinitrophenol ; 6-Isopropyl-3-methyl-2,4-dinitrophenol ; and 2,6-Dinitrothymol . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 128.8°C |
| Safety Data | |
 |
|
