| Identification | |
| Name: | 7-Quinolinamine,1-ethyl-1,2,3,4-tetrahydro- |
| Synonyms: | 1-ethyl-1,2,3,4-tetrahydroquinolin-7-amine;7-quinolinamine, 1-ethyl-1,2,3,4-tetrahydro-;1-ethyl-3,4-dihydro-2H-quinolin-7-amine; |
| CAS: | 303982-14-1 |
| Molecular Formula: | C11H16N2 |
| Molecular Weight: | 176.25814 |
| InChI: | InChI=1/C11H16N2/c1-2-13-7-3-4-9-5-6-10(12)8-11(9)13/h5-6,8H,2-4,7,12H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.054 |
| Refractive index: | 1.579 |
| Specification: |
The 1-Ethyl-7-amino-1,2,3,4-tetrahydroquinoline, with the CAS registry number 303982-14-1, has the systematic name of 1-ethyl-1,2,3,4-tetrahydroquinolin-7-amine. It is a kind of organics, and should be stored in the dry and cool environment. And the molecular formula of the chemical is C11H16N2. The characteristics of 1-Ethyl-7-amino-1,2,3,4-tetrahydroquinoline are as followings: (1)ACD/LogP: 2.28; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1; (4)ACD/LogD (pH 7.4): 2; (5)ACD/BCF (pH 5.5): 3; (6)ACD/BCF (pH 7.4): 28; (7)ACD/KOC (pH 5.5): 33; (8)ACD/KOC (pH 7.4): 360; (9)#H bond acceptors: 2; (10)#H bond donors: 2; (11)#Freely Rotating Bonds: 2; (12)Polar Surface Area: 29.26 Å2; (13)Index of Refraction: 1.579; (14)Molar Refractivity: 55.556 cm3; (15)Molar Volume: 167.178 cm3; (16)Polarizability: 22.024×10-24cm3; (17)Surface Tension: 42.536 dyne/cm; (18)Density: 1.054 g/cm3; (19)Flash Point: 141.378 °C; (20)Enthalpy of Vaporization: 59.164 kJ/mol; (21)Boiling Point: 347.372 °C at 760 mmHg; (22)Vapour Pressure: 0 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Safety Data | |
 |
|
