| Identification |
| Name: | Methyl 3-oxopentanoate |
| Synonyms: | METHYL-3-OXO PENTANOATE |
| CAS: | 30414-53-0 |
| EINECS: | 250-184-3 |
| Molecular Formula: | C6H10O3 |
| Molecular Weight: | 130.14 |
| InChI: | InChI=1/C6H10O3/c1-3-5(7)4-6(8)9-2/h3-4H2,1-2H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.037 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.422-1.424 |
| Water Solubility: | SLIGHTLY SOLUBLE |
| Solubility: | slightly soluble in Water |
| Appearance: | Colourless, transparent liquid |
| HS Code: | 29183000 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
