| Identification | |
| Name: | 4-Methylthieno[3,2-c]pyridine |
| Synonyms: | 5-methyl-9-thia-4-azabicyclo[4.3.0]nona-2,4,7,10-tetraene;4,5,6,7-Tetrahydrothieno[3,2,c]pyridine hydrochloride; |
| CAS: | 30433-78-4 |
| Molecular Formula: | C8H7NS |
| Molecular Weight: | 149.2129 |
| InChI: | InChI=1/C8H7NS/c1-6-7-3-5-10-8(7)2-4-9-6/h2-5H,1H3 |
| Molecular Structure: | ![(C8H7NS) 5-methyl-9-thia-4-azabicyclo[4.3.0]nona-2,4,7,10-tetraene;4,5,6,7-Tetrahydrothieno[3,2,c]pyridine hy...](https://img1.guidechem.com/chem/e/dict/9/30433-78-4.jpg) |
| Properties | |
| Flash Point: | 111.2°C |
| Boiling Point: | 258.6°Cat760mmHg |
| Density: | 1.217g/cm3 |
| Refractive index: | 1.663 |
| Specification: |
The 4-Methylthieno[3,2-c]pyridine with its cas register number is 4-Methylthieno[3,2-c]pyridine. It also can be called as 5-methyl-9-thia-4-azabicyclo[4.3.0]nona-2,4,7,10-tetraene and the IUPAC Name about this chemical is 4-methylthieno[3,2-c]pyridine. It belongs to the Thienopyridine. Physical properties about 4-Methylthieno[3,2-c]pyridine are: (1)ACD/LogP: 3.35; (2)#H bond acceptors:; (3)Polar Surface Area: 41.13Å2; (4)Index of Refraction: 1.663; (5)Molar Refractivity: 45.39 cm3; (6)Molar Volume: 122.5 cm3; (7)Polarizability: 17.99x10-24cm3; (8)Surface Tension: 50.1 dyne/cm; (9)Enthalpy of Vaporization: 47.62 kJ/mol; (10)Vapour Pressure: 0.022 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 111.2°C |
| Safety Data | |
 |
|
