| Identification | |
| Name: | 1H-Benzimidazol-2-amine,6-fluoro- |
| Synonyms: | 1H-Benzimidazol-2-amine,5-fluoro- (9CI); Benzimidazole, 2-amino-5-fluoro- (8CI) |
| CAS: | 30486-73-8 |
| Molecular Formula: | C7H6 F N3 |
| Molecular Weight: | 151.14 |
| InChI: | InChI=1/C7H6FN3/c8-4-1-2-5-6(3-4)11-7(9)10-5/h1-3H,(H3,9,10,11) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 179.3°C |
| Boiling Point: | 372.8°C at 760 mmHg |
| Density: | 1.487g/cm3 |
| Refractive index: | 1.737 |
| Specification: |
The 2-Amino-5-fluorobenzimidazole with the CAS number 30486-73-8 is also called 1H-Benzimidazol-2-amine,6-fluoro-. The systematic name is 5-fluoro-1H-benzimidazol-2-amine. Its molecular formula is C7H6FN3. The product category is benzimidazole. The properties of the chemical are: (1)ACD/LogP: 0.83; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 7.4): 0.76; (4)ACD/BCF (pH 5.5): 1; (5)ACD/BCF (pH 7.4): 2.12; (6)ACD/KOC (pH 5.5): 4.44; (7)ACD/KOC (pH 7.4): 56.77; (8)#H bond acceptors: 3; (9)#H bond donors: 3; (10)#Freely Rotating Bonds: 0; (11)Polar Surface Area: 54.7 Å2; (12)Index of Refraction: 1.737; (13)Molar Refractivity: 40.84 cm3; (14)Molar Volume: 101.5 cm3; (15)Polarizability: 16.19×10-24cm3; (16)Surface Tension: 73.8 dyne/cm; (17)Enthalpy of Vaporization: 62 kJ/mol; (18)Vapour Pressure: 9.38×10-6 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 179.3°C |
| Safety Data | |
 |
|
