| Identification | |
| Name: | 2H-Indol-2-one,1,3-dihydro-5,7-dinitro- |
| Synonyms: | 2-Indolinone,5,7-dinitro- (8CI); 5,7-Dinitro-2-oxindole; 5,7-Dinitrooxindole |
| CAS: | 30490-21-2 |
| Molecular Formula: | C8H5 N3 O5 |
| Molecular Weight: | 223.1424 |
| InChI: | InChI=1/C8H5N3O5/c12-7-2-4-1-5(10(13)14)3-6(11(15)16)8(4)9-7/h1,3H,2H2,(H,9,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 228.5°C |
| Boiling Point: | 454.2°Cat760mmHg |
| Density: | 1.656g/cm3 |
| Refractive index: | 1.67 |
| Specification: |
2H-Indol-2-one,1,3-dihydro-5,7-dinitro- , with CAS number of 30490-21-2, can be called 5,7-Dinitrooxindole ; 5,7-Dinitro-2-oxindole . |
| Flash Point: | 228.5°C |
| Safety Data | |
 |
|
