| Identification | |
| Name: | 2,1,3-Benzothiadiazol-4-amine,5-chloro- |
| Synonyms: | 5-Chloro-4-amino-2,1,3-benzothiadiazole; |
| CAS: | 30536-19-7 |
| Molecular Formula: | C6H4ClN3S |
| Molecular Weight: | 185.63 |
| InChI: | InChI=1/C6H4ClN3S/c7-3-1-2-4-6(5(3)8)10-11-9-4/h1-2H,8H2 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 95-96 ºC |
| Flash Point: | 145.1 ºC |
| Boiling Point: | 316.4 ºCat 760 mmHg |
| Density: | 1.632 g/cm3 |
| Refractive index: | 1.781 |
| Appearance: | Pale yellow crystalline powder |
| Specification: |
2,1,3-Benzothiadiazol-4-amine,5-chloro- , its cas register number is 30536-19-7. It also can be called 4-Amino-5-chloropiazthiole ; and 5-chloro-2,1,3-benzothiadiazol-4-amine . |
| Flash Point: | 145.1 ºC |
| Safety Data | |
 |
|
