Identification |
Name: | Carbamodithioic acid,dimethyl-, 3-oxobutyl ester (9CI) |
Synonyms: | Carbamicacid, dimethyldithio-, ester with 4-mercapto-2-butanone (8CI); 3-OxobutylN,N-dimethyldithiocarbamate |
CAS: | 30538-01-3 |
Molecular Formula: | C7H13 N O S2 |
Molecular Weight: | 0 |
InChI: | InChI=1/C7H13NOS2/c1-6(9)4-5-11-7(10)8(2)3/h4-5H2,1-3H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 119.1°C |
Boiling Point: | 273.3°C at 760 mmHg |
Density: | 1.142g/cm3 |
Refractive index: | 1.552 |
Flash Point: | 119.1°C |
Safety Data |
|
 |