| Identification | |
| Name: | 4(1H)-Pyridinone,3-hydroxy-1,2-dimethyl- |
| Synonyms: | 4(1H)-Pyridone,3-hydroxy-1,2-dimethyl- (8CI);1,2-Dimethyl-3-hydroxy-4(1H)-pyridinone;1,2-Dimethyl-3-hydroxypyridin-4-one;1,2-Dimethyl-3-hydroxypyridine-4-one;3-Hydroxy-1,2-dimethyl-4(1H)-pyridinone;3-Hydroxy-1,2-dimethyl-4(1H)-pyridone;3-Hydroxy-1,2-dimethyl-4-pyridinone;3-Hydroxy-1,2-dimethyl-4-pyridone;APO 66;CGP 37391;CP 20 (chelatingagent);DN 18001AF;Deferiprone;Ferriprox;L 1 (chelatingagent); |
| CAS: | 30652-11-0 |
| EINECS: | 212-783-8 |
| Molecular Formula: | C7H9NO2 |
| Molecular Weight: | 139.15 |
| InChI: | InChI=1/C7H9NO2/c1-5-7(10)6(9)3-4-8(5)2/h3-4,10H,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.225 g/cm3 |
| Refractive index: | 1.564 |
| Water Solubility: | soluble in hot water |
| Solubility: | soluble in hot water |
| Appearance: | White needles |
| Usage: | A chelator that could replace disferrioxamine. It is orally and parenterally effective in the removal of iron in vivo from rabbits and mice and also from transferrin and ferritin in vitro |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
