| Identification |
| Name: | 1,2,4-Butanetriol |
| Synonyms: | Butanetriol,97% |
| CAS: | 3068-00-6 |
| EINECS: | 221-323-5 |
| Molecular Formula: | C4H10O3 |
| Molecular Weight: | 106.12 |
| InChI: | InChI=1/C4H10O3/c5-2-1-4(7)3-6/h4-7H,1-3H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | 200kgs |
| Density: | 1.018 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | 1.4738-1.4758 |
| Solubility: | Very soluble |
| Appearance: | clear yellow to slightly brownish liquid |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Store protected from moisture. |
| Sensitive: | Hygroscopic |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
