| Identification | |
| Name: | D-Glucose,4,6-O-(phenylmethylene)- |
| Synonyms: | D-Glucose,4,6-O-benzylidene- (7CI,8CI);4,6-O-Benzylidene-D-glucose;(2R,3R)-2,3-dihydroxy-3-[(4R,5R)-5-hydroxy-2-phenyl-1,;4,6-Benzylidene-D-glucose;D-Glucose, 4,6-O-(phenylmethylene)-; |
| CAS: | 30688-66-5 |
| Molecular Formula: | C13H16O6 |
| Molecular Weight: | 268.2625 |
| InChI: | InChI=1/C13H16O6/c14-6-9(15)11(17)12-10(16)7-18-13(19-12)8-4-2-1-3-5-8/h1-6,9-13,15-17H,7H2/t9-,10+,11+,12+,13?/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 201.7 |
| Density: | 1.379 g/cm3 |
| Refractive index: | 1.58 |
| Specification: |
The 4,6-O-Benzylidene-D-glucopyranose, with the cas registry number 30688-66-5 and EINECS registry number 271-896-0, is also called 4,6-O-(Phenylmethylene)-D-glucose. The molecular formula of the chemical is C13H16O6. The characteristics of this chemical are as followings: (1)ACD/LogP: 1.60; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.6; (4)ACD/LogD (pH 7.4): 1.6; (5)ACD/BCF (pH 5.5): 9.71; (6)ACD/BCF (pH 7.4): 9.71; (7)ACD/KOC (pH 5.5): 177.1; (8)ACD/KOC (pH 7.4): 177.1; (9)#H bond acceptors: 6; (10)#H bond donors: 3; (11)#Freely Rotating Bonds: 7; (12)Polar Surface Area: 63.22 Å2; (13)Index of Refraction: 1.58; (14)Molar Refractivity: 64.77 cm3; (15)Molar Volume: 194.5 cm3; (16)Polarizability: 25.67×10-24cm3; (17)Surface Tension: 61.6 dyne/cm; (18)Density: 1.379 g/cm3; (19)Flash Point: 201.7 °C; (20)Enthalpy of Vaporization: 83.68 kJ/mol; (21)Boiling Point: 521.6 °C at 760 mmHg; (22)Vapour Pressure: 1.05E-11 mmHg at 25°C. Addtionally, the following datas could be converted into the molecular structure: |
| Flash Point: | 201.7 |
| Safety Data | |
 |
|
