| Identification |
| Name: | Butanoic acid,3-[2-[3-methoxy-1-(methoxymethyl)propylidene]hydrazinylidene]-, ethyl ester |
| Synonyms: | Acetoaceticacid, ethyl ester, 3-azine with 1,4-dimethoxy-2-butanone (8CI); 2-Butanone,1,4-dimethoxy-, 3-azine with ethyl acetoacetate (8CI); NSC 114119 |
| CAS: | 30692-37-6 |
| Molecular Formula: | C12H22 N2 O4 |
| Molecular Weight: | 258.3141 |
| InChI: | InChI=1/C12H22N2O4/c1-5-18-12(15)8-10(2)13-14-11(9-17-4)6-7-16-3/h5-9H2,1-4H3/b13-10u,14-11- |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 116.4°C |
| Boiling Point: | 323°Cat760mmHg |
| Density: | 1.03g/cm3 |
| Refractive index: | 1.461 |
| Flash Point: | 116.4°C |
| Safety Data |
| |
 |
