Identification |
Name: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with 2-ethylhexyl 2-propenoate and 2-propenoic acid |
Synonyms: | 2-Propenoic acid, 2-methyl-, methyl ester, polymer with 2-ethylhexyl 2-propenoate and 2-propenoic acid;Acrylic acid, 2-ethylhexyl acrylate, methyl methacrylate polymer;methyl methacrylate/ 2-ethylhexyl acrylate/ acrylic acid |
CAS: | 30705-21-6 |
Molecular Formula: | C19H34O6 |
Molecular Weight: | 0 |
InChI: | InChI=1/C12H22O2.C4H8O2.C3H4O2/c1-4-6-7-11(5-2)9-8-10(3)12(13)14;1-3-4(5)6-2;1-2-3(4)5/h11H,3-9H2,1-2H3,(H,13,14);3H2,1-2H3;2H,1H2,(H,4,5) |
Molecular Structure: |
 |
Properties |
Flash Point: | 208.1°C |
Boiling Point: | 302.7°C at 760 mmHg |
Flash Point: | 208.1°C |
Safety Data |
|
 |