Identification |
Name: | 2-Amino-5-nitropyrimidine |
Synonyms: | 2-Pyrimidinamine, 5-nitro-;5-Nitropyrimidin-2-amine;2-amie-5-nitropyrimidine;5-nitro-pyrimidin-2-ylamine; |
CAS: | 3073-77-6 |
EINECS: | 221-348-1 |
Molecular Formula: | C4H4N4O2 |
Molecular Weight: | 140.1 |
InChI: | InChI=1/C4H4N4O2/c5-4-6-1-3(2-7-4)8(9)10/h1-2H,(H2,5,6,7) |
Molecular Structure: |
|
Properties |
Density: | 1.556 g/cm3 |
Stability: | Stable under normal temperatures and pressures. |
Refractive index: | 1.659 |
Solubility: | Soluble |
Appearance: | YELLOW TO TAN POWDER |
Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
Safety Data |
Hazard Symbols |
Xi:Irritant
|
|
|