| Identification |
| Name: | 2-Amino-5-nitropyrimidine |
| Synonyms: | 2-Pyrimidinamine, 5-nitro-;5-Nitropyrimidin-2-amine;2-amie-5-nitropyrimidine;5-nitro-pyrimidin-2-ylamine; |
| CAS: | 3073-77-6 |
| EINECS: | 221-348-1 |
| Molecular Formula: | C4H4N4O2 |
| Molecular Weight: | 140.1 |
| InChI: | InChI=1/C4H4N4O2/c5-4-6-1-3(2-7-4)8(9)10/h1-2H,(H2,5,6,7) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.556 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.659 |
| Solubility: | Soluble |
| Appearance: | YELLOW TO TAN POWDER |
| Storage Temperature: | Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| Hazard Symbols |
Xi:Irritant
|
| |
 |
