Identification |
Name: | Oxazole,2,2'-(1,4-phenylene)bis[4-methyl-5-phenyl- |
Synonyms: | Oxazole,2,2'-p-phenylenebis[4-methyl-5-phenyl- (7CI,8CI);1,4-Bis(4-methyl-5-phenyl-2-oxazolyl)benzene; 1,4-Bis[2-(4-methyl-5-phenyloxazolyl)]benzene;1,4-Bis[2-(4-methyl-5-phenyloxazolylyl)]benzene;2,2'-p-Phenylenebis(4-methyl-5-phenyloxazole);2-p-Phenylenebis(4-methyl-5-phenyloxazole); DMPOPOP; Dimethyl-POPOP;p-Bis(2-(4-methyl-5-phenyloxazolyl))benzene |
CAS: | 3073-87-8 |
EINECS: | 221-349-7 |
Molecular Formula: | C26H20 N2 O2 |
Molecular Weight: | 392.4493 |
InChI: | InChI=1S/C26H20N2O2/c1-17-23(19-9-5-3-6-10-19)29-25(27-17)21-13-15-22(16-14-21)26-28-18(2)24(30-26)20-11-7-4-8-12-20/h3-16H,1-2H3 |
Molecular Structure: |
|
Properties |
Melting Point: | 233-235 °C(lit.) |
Flash Point: | 571.7°Cat760mmHg |
Boiling Point: | 571.7°Cat760mmHg |
Density: | 1.17g/cm3 |
Stability: | Stable. Incompatible with strong oxidizing agents. |
Refractive index: | 1.602 |
Water Solubility: | negligible Stability Stable. Incompatible with strong oxidizing agents. Toxicology Harmful if swallowed, inhaled or absorbed through the skin. Toxicity data (The |
Solubility: | negligible Stability Stable. Incompatible with strong oxidizing agents. Toxicology Harmful if swallowed, inhaled or absorbed through the skin. Toxicity data (The |
Appearance: | yellow needles with a blue fluorescence |
Flash Point: | 571.7°Cat760mmHg |
Safety Data |
|
|